C20H24ClN3O6S — CID 108896765
1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(3,4-dimethoxyphenyl)methyl]urea (PubChem CID 108896765) has the molecular formula C20H24ClN3O6S and a molecular weight of 469.95 g/mol. Its IUPAC name is 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(3,4-dimethoxyphenyl)methyl]urea.
| Compound Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(3,4-dimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 108896765 |
| Molecular Formula | C20H24ClN3O6S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(3,4-dimethoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)cc1OC |
| InChI | InChI=1S/C20H24ClN3O6S/c1-28-18-6-3-14(11-19(18)29-2)13-22-20(25)23-17-12-15(4-5-16(17)21)31(26,27)24-7-9-30-10-8-24/h3-6,11-12H,7-10,13H2,1-2H3,(H2,22,23,25) |
| InChIKey | XHGVRJKXEWIITL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |