C16H22ClN3O4S — CID 108911015
1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(E)-3-methylbut-1-enyl]urea (PubChem CID 108911015) has the molecular formula C16H22ClN3O4S and a molecular weight of 387.89 g/mol. Its IUPAC name is 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(E)-3-methylbut-1-enyl]urea.
| Compound Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(E)-3-methylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108911015 |
| Molecular Formula | C16H22ClN3O4S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(E)-3-methylbut-1-enyl]urea |
| SMILES | CC(C)/C=C/NC(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C16H22ClN3O4S/c1-12(2)5-6-18-16(21)19-15-11-13(3-4-14(15)17)25(22,23)20-7-9-24-10-8-20/h3-6,11-12H,7-10H2,1-2H3,(H2,18,19,21)/b6-5+ |
| InChIKey | YEJLPZZCOHTFCV-AATRIKPKSA-N |
| XLogP | 2.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |