C16H24ClN3O3S2 — CID 8618275
1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(2R)-pentan-2-yl]thiourea (PubChem CID 8618275) has the molecular formula C16H24ClN3O3S2 and a molecular weight of 405.97 g/mol. Its IUPAC name is 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(2R)-pentan-2-yl]thiourea.
| Compound Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(2R)-pentan-2-yl]thiourea |
|---|---|
| PubChem CID | 8618275 |
| Molecular Formula | C16H24ClN3O3S2 |
| Molecular Weight | 405.97 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(2R)-pentan-2-yl]thiourea |
| SMILES | CCC[C@@H](C)NC(=S)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C16H24ClN3O3S2/c1-3-4-12(2)18-16(24)19-15-11-13(5-6-14(15)17)25(21,22)20-7-9-23-10-8-20/h5-6,11-12H,3-4,7-10H2,1-2H3,(H2,18,19,24)/t12-/m1/s1 |
| InChIKey | PGUZWAHGAFVLLU-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.97 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|