C17H24ClN3O3S2 — CID 8625398
(2R)-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-methylpiperidine-1-carbothioamide (PubChem CID 8625398) has the molecular formula C17H24ClN3O3S2 and a molecular weight of 417.98 g/mol. Its IUPAC name is (2R)-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-methylpiperidine-1-carbothioamide.
| Compound Name | (2R)-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-methylpiperidine-1-carbothioamide |
|---|---|
| PubChem CID | 8625398 |
| Molecular Formula | C17H24ClN3O3S2 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | (2R)-N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-methylpiperidine-1-carbothioamide |
| SMILES | C[C@@H]1CCCCN1C(=S)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C17H24ClN3O3S2/c1-13-4-2-3-7-21(13)17(25)19-16-12-14(5-6-15(16)18)26(22,23)20-8-10-24-11-9-20/h5-6,12-13H,2-4,7-11H2,1H3,(H,19,25)/t13-/m1/s1 |
| InChIKey | QBSCINKKVKEWIC-CYBMUJFWSA-N |
| XLogP | 2.93 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|