C15H19ClN4O4S2 — CID 8625090
1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(cyclopropanecarbonylamino)thiourea (PubChem CID 8625090) has the molecular formula C15H19ClN4O4S2 and a molecular weight of 418.93 g/mol. Its IUPAC name is 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(cyclopropanecarbonylamino)thiourea.
| Compound Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(cyclopropanecarbonylamino)thiourea |
|---|---|
| PubChem CID | 8625090 |
| Molecular Formula | C15H19ClN4O4S2 |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-(cyclopropanecarbonylamino)thiourea |
| SMILES | O=C(NNC(=S)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl)C1CC1 |
| InChI | InChI=1S/C15H19ClN4O4S2/c16-12-4-3-11(26(22,23)20-5-7-24-8-6-20)9-13(12)17-15(25)19-18-14(21)10-1-2-10/h3-4,9-10H,1-2,5-8H2,(H,18,21)(H2,17,19,25) |
| InChIKey | ORINIDFHSRSXHI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|