C17H16Cl2F3N5O3S2 — CID 4985219
1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]thiourea (PubChem CID 4985219) has the molecular formula C17H16Cl2F3N5O3S2 and a molecular weight of 530.38 g/mol. Its IUPAC name is 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]thiourea.
| Compound Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]thiourea |
|---|---|
| PubChem CID | 4985219 |
| Molecular Formula | C17H16Cl2F3N5O3S2 |
| Molecular Weight | 530.38 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]thiourea |
| SMILES | O=S(=O)(c1ccc(Cl)c(NC(=S)NNc2ncc(C(F)(F)F)cc2Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C17H16Cl2F3N5O3S2/c18-12-2-1-11(32(28,29)27-3-5-30-6-4-27)8-14(12)24-16(31)26-25-15-13(19)7-10(9-23-15)17(20,21)22/h1-2,7-9H,3-6H2,(H,23,25)(H2,24,26,31) |
| InChIKey | XZRXVSLCYYFCOX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|