C17H13ClF4N2O4S — CID 4641528
N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2,3,4,5-tetrafluorobenzamide (PubChem CID 4641528) has the molecular formula C17H13ClF4N2O4S and a molecular weight of 452.81 g/mol. Its IUPAC name is N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2,3,4,5-tetrafluorobenzamide.
| Compound Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2,3,4,5-tetrafluorobenzamide |
|---|---|
| PubChem CID | 4641528 |
| Molecular Formula | C17H13ClF4N2O4S |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2,3,4,5-tetrafluorobenzamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H13ClF4N2O4S/c18-11-2-1-9(29(26,27)24-3-5-28-6-4-24)7-13(11)23-17(25)10-8-12(19)15(21)16(22)14(10)20/h1-2,7-8H,3-6H2,(H,23,25) |
| InChIKey | DGWAFKLLIQFYNY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|