C16H17ClN2O5S — CID 108791562
N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-5-methylfuran-2-carboxamide (PubChem CID 108791562) has the molecular formula C16H17ClN2O5S and a molecular weight of 384.84 g/mol. Its IUPAC name is N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-5-methylfuran-2-carboxamide.
| Compound Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 108791562 |
| Molecular Formula | C16H17ClN2O5S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)o1 |
| InChI | InChI=1S/C16H17ClN2O5S/c1-11-2-5-15(24-11)16(20)18-14-10-12(3-4-13(14)17)25(21,22)19-6-8-23-9-7-19/h2-5,10H,6-9H2,1H3,(H,18,20) |
| InChIKey | HYSWKGGOLJLGLE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |