C17H19ClN2O6S — CID 39802239
5-chloro-N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide (PubChem CID 39802239) has the molecular formula C17H19ClN2O6S and a molecular weight of 414.87 g/mol. Its IUPAC name is 5-chloro-N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide.
| Compound Name | 5-chloro-N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 39802239 |
| Molecular Formula | C17H19ClN2O6S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 5-chloro-N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)furan-2-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C17H19ClN2O6S/c1-2-25-14-4-3-12(27(22,23)20-7-9-24-10-8-20)11-13(14)19-17(21)15-5-6-16(18)26-15/h3-6,11H,2,7-10H2,1H3,(H,19,21) |
| InChIKey | WCGPDWMOEILQCB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |