C19H20F2N2O5S — CID 26892844
N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-2,6-difluorobenzamide (PubChem CID 26892844) has the molecular formula C19H20F2N2O5S and a molecular weight of 426.44 g/mol. Its IUPAC name is N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-2,6-difluorobenzamide.
| Compound Name | N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 26892844 |
| Molecular Formula | C19H20F2N2O5S |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-(2-ethoxy-5-morpholin-4-ylsulfonylphenyl)-2,6-difluorobenzamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C19H20F2N2O5S/c1-2-28-17-7-6-13(29(25,26)23-8-10-27-11-9-23)12-16(17)22-19(24)18-14(20)4-3-5-15(18)21/h3-7,12H,2,8-11H2,1H3,(H,22,24) |
| InChIKey | YJDWSGQURGNGSR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |