C17H25ClN4O4S — CID 24980260
N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 24980260) has the molecular formula C17H25ClN4O4S and a molecular weight of 416.93 g/mol. Its IUPAC name is N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 24980260 |
| Molecular Formula | C17H25ClN4O4S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(CC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H25ClN4O4S/c1-20-4-6-21(7-5-20)13-17(23)19-16-12-14(2-3-15(16)18)27(24,25)22-8-10-26-11-9-22/h2-3,12H,4-11,13H2,1H3,(H,19,23) |
| InChIKey | KMVGXNXSHRXKFM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |