C17H25ClN3O4S+ — CID 8903916
N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-morpholin-4-ium-4-ylacetamide (PubChem CID 8903916) has the molecular formula C17H25ClN3O4S+ and a molecular weight of 402.92 g/mol. Its IUPAC name is N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-morpholin-4-ium-4-ylacetamide.
| Compound Name | N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-morpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 8903916 |
| Molecular Formula | C17H25ClN3O4S+ |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-morpholin-4-ium-4-ylacetamide |
| SMILES | O=C(C[NH+]1CCOCC1)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C17H24ClN3O4S/c18-15-5-4-14(26(23,24)21-6-2-1-3-7-21)12-16(15)19-17(22)13-20-8-10-25-11-9-20/h4-5,12H,1-3,6-11,13H2,(H,19,22)/p+1 |
| InChIKey | YGDKMGUAYDJKCL-UHFFFAOYSA-O |
| XLogP | 0.37 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |