C18H21ClN3O4S+ — CID 30234663
N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-(4-methylpyridin-1-ium-1-yl)acetamide (PubChem CID 30234663) has the molecular formula C18H21ClN3O4S+ and a molecular weight of 410.90 g/mol. Its IUPAC name is N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-(4-methylpyridin-1-ium-1-yl)acetamide.
| Compound Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-(4-methylpyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 30234663 |
| Molecular Formula | C18H21ClN3O4S+ |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-(4-methylpyridin-1-ium-1-yl)acetamide |
| SMILES | Cc1cc[n+](CC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3O4S/c1-14-4-6-21(7-5-14)13-18(23)20-17-12-15(2-3-16(17)19)27(24,25)22-8-10-26-11-9-22/h2-7,12H,8-11,13H2,1H3/p+1 |
| InChIKey | DFCJODADYRVTMI-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|