C18H20ClN4O5S+ — CID 31336023
1-[2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide (PubChem CID 31336023) has the molecular formula C18H20ClN4O5S+ and a molecular weight of 439.90 g/mol. Its IUPAC name is 1-[2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 31336023 |
| Molecular Formula | C18H20ClN4O5S+ |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 1-[2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1ccc[n+](CC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)c1 |
| InChI | InChI=1S/C18H19ClN4O5S/c19-15-4-3-14(29(26,27)23-6-8-28-9-7-23)10-16(15)21-17(24)12-22-5-1-2-13(11-22)18(20)25/h1-5,10-11H,6-9,12H2,(H2-,20,21,24,25)/p+1 |
| InChIKey | OCRAZQXMJXHOIZ-UHFFFAOYSA-O |
| XLogP | 0.39 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|