C16H16ClN5O5S — CID 108520203
N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N'-pyrimidin-2-yloxamide (PubChem CID 108520203) has the molecular formula C16H16ClN5O5S and a molecular weight of 425.85 g/mol. Its IUPAC name is N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N'-pyrimidin-2-yloxamide.
| Compound Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N'-pyrimidin-2-yloxamide |
|---|---|
| PubChem CID | 108520203 |
| Molecular Formula | C16H16ClN5O5S |
| Molecular Weight | 425.85 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N'-pyrimidin-2-yloxamide |
| SMILES | O=C(Nc1ncccn1)C(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C16H16ClN5O5S/c17-12-3-2-11(28(25,26)22-6-8-27-9-7-22)10-13(12)20-14(23)15(24)21-16-18-4-1-5-19-16/h1-5,10H,6-9H2,(H,20,23)(H,18,19,21,24) |
| InChIKey | HULDVRJBPZCWER-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.85 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|