C16H22ClN3O7S — CID 108520219
N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide (PubChem CID 108520219) has the molecular formula C16H22ClN3O7S and a molecular weight of 435.89 g/mol. Its IUPAC name is N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide.
| Compound Name | N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide |
|---|---|
| PubChem CID | 108520219 |
| Molecular Formula | C16H22ClN3O7S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N'-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide |
| SMILES | O=C(NCCOCCO)C(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C16H22ClN3O7S/c17-13-2-1-12(28(24,25)20-4-8-27-9-5-20)11-14(13)19-16(23)15(22)18-3-7-26-10-6-21/h1-2,11,21H,3-10H2,(H,18,22)(H,19,23) |
| InChIKey | CCRRAYXFGYVGMT-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|