C18H18Cl3N3O5S — CID 108880970
1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(2,4-dichlorophenoxy)methyl]urea (PubChem CID 108880970) has the molecular formula C18H18Cl3N3O5S and a molecular weight of 494.78 g/mol. Its IUPAC name is 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(2,4-dichlorophenoxy)methyl]urea.
| Compound Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(2,4-dichlorophenoxy)methyl]urea |
|---|---|
| PubChem CID | 108880970 |
| Molecular Formula | C18H18Cl3N3O5S |
| Molecular Weight | 494.78 g/mol |
| Exact Mass | 493.00 |
| IUPAC Name | 1-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-3-[(2,4-dichlorophenoxy)methyl]urea |
| SMILES | O=C(NCOc1ccc(Cl)cc1Cl)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C18H18Cl3N3O5S/c19-12-1-4-17(15(21)9-12)29-11-22-18(25)23-16-10-13(2-3-14(16)20)30(26,27)24-5-7-28-8-6-24/h1-4,9-10H,5-8,11H2,(H2,22,23,25) |
| InChIKey | QXSXIEJPRZTTDB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.78 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|