C19H18Cl2N2O7S — CID 4079305
[2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate (PubChem CID 4079305) has the molecular formula C19H18Cl2N2O7S and a molecular weight of 489.33 g/mol. Its IUPAC name is [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate.
| Compound Name | [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 4079305 |
| Molecular Formula | C19H18Cl2N2O7S |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)ccc1O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O7S/c20-12-1-4-17(24)14(9-12)19(26)30-11-18(25)22-16-10-13(2-3-15(16)21)31(27,28)23-5-7-29-8-6-23/h1-4,9-10,24H,5-8,11H2,(H,22,25) |
| InChIKey | QCFISHUIPGIQCS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |