C21H23ClN2O8S — CID 4002541
[2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate (PubChem CID 4002541) has the molecular formula C21H23ClN2O8S and a molecular weight of 498.94 g/mol. Its IUPAC name is [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate.
| Compound Name | [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 4002541 |
| Molecular Formula | C21H23ClN2O8S |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate |
| SMILES | COc1ccc(OCC(=O)OCC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H23ClN2O8S/c1-29-15-2-4-16(5-3-15)31-14-21(26)32-13-20(25)23-19-12-17(6-7-18(19)22)33(27,28)24-8-10-30-11-9-24/h2-7,12H,8-11,13-14H2,1H3,(H,23,25) |
| InChIKey | FKHRRCYJWSPWJD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |