C23H29N3O8S2 — CID 3445466
N-(2-methyl-5-morpholin-4-ylsulfonylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide (PubChem CID 3445466) has the molecular formula C23H29N3O8S2 and a molecular weight of 539.63 g/mol. Its IUPAC name is N-(2-methyl-5-morpholin-4-ylsulfonylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide.
| Compound Name | N-(2-methyl-5-morpholin-4-ylsulfonylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 3445466 |
| Molecular Formula | C23H29N3O8S2 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | N-(2-methyl-5-morpholin-4-ylsulfonylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)COc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H29N3O8S2/c1-18-2-5-21(36(30,31)26-10-14-33-15-11-26)16-22(18)24-23(27)17-34-19-3-6-20(7-4-19)35(28,29)25-8-12-32-13-9-25/h2-7,16H,8-15,17H2,1H3,(H,24,27) |
| InChIKey | QIHYVSHIKBTILL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |