C19H23N3O7S2 — CID 30835139
N-(4-methyl-3-sulfamoylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide (PubChem CID 30835139) has the molecular formula C19H23N3O7S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-(4-methyl-3-sulfamoylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide.
| Compound Name | N-(4-methyl-3-sulfamoylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 30835139 |
| Molecular Formula | C19H23N3O7S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-(4-methyl-3-sulfamoylphenyl)-2-(4-morpholin-4-ylsulfonylphenoxy)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H23N3O7S2/c1-14-2-3-15(12-18(14)30(20,24)25)21-19(23)13-29-16-4-6-17(7-5-16)31(26,27)22-8-10-28-11-9-22/h2-7,12H,8-11,13H2,1H3,(H,21,23)(H2,20,24,25) |
| InChIKey | NGUILSPXGBKFFT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |