C18H24N2O6S — CID 8760061
[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 8760061) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 8760061 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OCC(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1C |
| InChI | InChI=1S/C18H24N2O6S/c1-13(2)10-18(22)26-12-17(21)19-16-11-15(5-4-14(16)3)27(23,24)20-6-8-25-9-7-20/h4-5,10-11H,6-9,12H2,1-3H3,(H,19,21) |
| InChIKey | NTSFFXKHURHWAT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|