C23H26N2O7S — CID 6121329
[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate (PubChem CID 6121329) has the molecular formula C23H26N2O7S and a molecular weight of 474.54 g/mol. Its IUPAC name is [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6121329 |
| Molecular Formula | C23H26N2O7S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2C)c1 |
| InChI | InChI=1S/C23H26N2O7S/c1-17-6-8-20(33(28,29)25-10-12-31-13-11-25)15-21(17)24-22(26)16-32-23(27)9-7-18-4-3-5-19(14-18)30-2/h3-9,14-15H,10-13,16H2,1-2H3,(H,24,26)/b9-7+ |
| InChIKey | AAXBCTYHPLYESV-VQHVLOKHSA-N |
| XLogP | 2.22 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|