C18H24N2O7S — CID 8673318
[2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-pent-2-enoate (PubChem CID 8673318) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is [2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-pent-2-enoate.
| Compound Name | [2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 8673318 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [2-(2-methoxy-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)OCC(=O)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1OC |
| InChI | InChI=1S/C18H24N2O7S/c1-3-4-5-18(22)27-13-17(21)19-15-12-14(6-7-16(15)25-2)28(23,24)20-8-10-26-11-9-20/h4-7,12H,3,8-11,13H2,1-2H3,(H,19,21)/b5-4+ |
| InChIKey | GZCJZXWCEHQHTQ-SNAWJCMRSA-N |
| XLogP | 1.16 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|