C23H30N2O7S — CID 4688141
4-(4-ethoxyphenoxy)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)butanamide (PubChem CID 4688141) has the molecular formula C23H30N2O7S and a molecular weight of 478.57 g/mol. Its IUPAC name is 4-(4-ethoxyphenoxy)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)butanamide.
| Compound Name | 4-(4-ethoxyphenoxy)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 4688141 |
| Molecular Formula | C23H30N2O7S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 4-(4-ethoxyphenoxy)-N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)butanamide |
| SMILES | CCOc1ccc(OCCCC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2OC)cc1 |
| InChI | InChI=1S/C23H30N2O7S/c1-3-31-18-6-8-19(9-7-18)32-14-4-5-23(26)24-21-17-20(10-11-22(21)29-2)33(27,28)25-12-15-30-16-13-25/h6-11,17H,3-5,12-16H2,1-2H3,(H,24,26) |
| InChIKey | LVJIJTYAZPHMRK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|