C22H28N2O6S — CID 38000923
4-(4-methoxyphenoxy)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)butanamide (PubChem CID 38000923) has the molecular formula C22H28N2O6S and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)butanamide.
| Compound Name | 4-(4-methoxyphenoxy)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 38000923 |
| Molecular Formula | C22H28N2O6S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-(4-methoxyphenoxy)-N-(2-methoxy-5-pyrrolidin-1-ylsulfonylphenyl)butanamide |
| SMILES | COc1ccc(OCCCC(=O)Nc2cc(S(=O)(=O)N3CCCC3)ccc2OC)cc1 |
| InChI | InChI=1S/C22H28N2O6S/c1-28-17-7-9-18(10-8-17)30-15-5-6-22(25)23-20-16-19(11-12-21(20)29-2)31(26,27)24-13-3-4-14-24/h7-12,16H,3-6,13-15H2,1-2H3,(H,23,25) |
| InChIKey | PZIRUZGJSYDOHK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|