C20H28N2O6S — CID 7722474
[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-cyclopentylacetate (PubChem CID 7722474) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-cyclopentylacetate.
| Compound Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 7722474 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-cyclopentylacetate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)COC(=O)CC1CCCC1 |
| InChI | InChI=1S/C20H28N2O6S/c1-15-6-7-17(29(25,26)22-8-10-27-11-9-22)13-18(15)21-19(23)14-28-20(24)12-16-4-2-3-5-16/h6-7,13,16H,2-5,8-12,14H2,1H3,(H,21,23) |
| InChIKey | WBHHDBRKRMINQR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |