C20H27ClN2O5S — CID 4622091
[2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-cyclopentylacetate (PubChem CID 4622091) has the molecular formula C20H27ClN2O5S and a molecular weight of 442.97 g/mol. Its IUPAC name is [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-cyclopentylacetate.
| Compound Name | [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 4622091 |
| Molecular Formula | C20H27ClN2O5S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-cyclopentylacetate |
| SMILES | O=C(COC(=O)CC1CCCC1)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C20H27ClN2O5S/c21-17-9-8-16(29(26,27)23-10-4-1-5-11-23)13-18(17)22-19(24)14-28-20(25)12-15-6-2-3-7-15/h8-9,13,15H,1-7,10-12,14H2,(H,22,24) |
| InChIKey | LAEJGRQPFRZEQW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |