C18H19ClN2O5S2 — CID 3273063
[2-(2-chloro-5-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 3273063) has the molecular formula C18H19ClN2O5S2 and a molecular weight of 442.95 g/mol. Its IUPAC name is [2-(2-chloro-5-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate.
| Compound Name | [2-(2-chloro-5-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 3273063 |
| Molecular Formula | C18H19ClN2O5S2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | [2-(2-chloro-5-pyrrolidin-1-ylsulfonylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | O=C(COC(=O)Cc1ccsc1)Nc1cc(S(=O)(=O)N2CCCC2)ccc1Cl |
| InChI | InChI=1S/C18H19ClN2O5S2/c19-15-4-3-14(28(24,25)21-6-1-2-7-21)10-16(15)20-17(22)11-26-18(23)9-13-5-8-27-12-13/h3-5,8,10,12H,1-2,6-7,9,11H2,(H,20,22) |
| InChIKey | MRASGRAKIWYLCT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |