C17H21ClN2O5S — CID 7699132
[2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (E)-but-2-enoate (PubChem CID 7699132) has the molecular formula C17H21ClN2O5S and a molecular weight of 400.88 g/mol. Its IUPAC name is [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (E)-but-2-enoate.
| Compound Name | [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 7699132 |
| Molecular Formula | C17H21ClN2O5S |
| Molecular Weight | 400.88 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C17H21ClN2O5S/c1-2-6-17(22)25-12-16(21)19-15-11-13(7-8-14(15)18)26(23,24)20-9-4-3-5-10-20/h2,6-8,11H,3-5,9-10,12H2,1H3,(H,19,21)/b6-2+ |
| InChIKey | AHECGQKPJFDXLN-QHHAFSJGSA-N |
| XLogP | 2.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|