C20H28N2O6S — CID 9080829
[2-oxo-2-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyanilino)ethyl] (E)-but-2-enoate (PubChem CID 9080829) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is [2-oxo-2-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyanilino)ethyl] (E)-but-2-enoate.
| Compound Name | [2-oxo-2-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyanilino)ethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 9080829 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [2-oxo-2-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyanilino)ethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1OC(C)C |
| InChI | InChI=1S/C20H28N2O6S/c1-4-8-20(24)27-14-19(23)21-17-13-16(9-10-18(17)28-15(2)3)29(25,26)22-11-6-5-7-12-22/h4,8-10,13,15H,5-7,11-12,14H2,1-3H3,(H,21,23)/b8-4+ |
| InChIKey | DTAKQXDDTNRNSE-XBXARRHUSA-N |
| XLogP | 2.71 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|