C22H30N2O4S2 — CID 26265407
N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)-4-thiophen-2-ylbutanamide (PubChem CID 26265407) has the molecular formula C22H30N2O4S2 and a molecular weight of 450.63 g/mol. Its IUPAC name is N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 26265407 |
| Molecular Formula | C22H30N2O4S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)-4-thiophen-2-ylbutanamide |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)CCCc1cccs1 |
| InChI | InChI=1S/C22H30N2O4S2/c1-17(2)28-21-12-11-19(30(26,27)24-13-4-3-5-14-24)16-20(21)23-22(25)10-6-8-18-9-7-15-29-18/h7,9,11-12,15-17H,3-6,8,10,13-14H2,1-2H3,(H,23,25) |
| InChIKey | SVZHQGNYKVLGDN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |