C19H23BrN2O4S2 — CID 26265446
5-bromo-N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)thiophene-2-carboxamide (PubChem CID 26265446) has the molecular formula C19H23BrN2O4S2 and a molecular weight of 487.44 g/mol. Its IUPAC name is 5-bromo-N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 26265446 |
| Molecular Formula | C19H23BrN2O4S2 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | 5-bromo-N-(5-piperidin-1-ylsulfonyl-2-propan-2-yloxyphenyl)thiophene-2-carboxamide |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C19H23BrN2O4S2/c1-13(2)26-16-7-6-14(28(24,25)22-10-4-3-5-11-22)12-15(16)21-19(23)17-8-9-18(20)27-17/h6-9,12-13H,3-5,10-11H2,1-2H3,(H,21,23) |
| InChIKey | VTFWFMJOCPOXNW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |