C24H28N2O8S — CID 16534709
[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate (PubChem CID 16534709) has the molecular formula C24H28N2O8S and a molecular weight of 504.56 g/mol. Its IUPAC name is [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate.
| Compound Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
|---|---|
| PubChem CID | 16534709 |
| Molecular Formula | C24H28N2O8S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-(4-propanoylphenoxy)acetate |
| SMILES | CCC(=O)c1ccc(OCC(=O)OCC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2C)cc1 |
| InChI | InChI=1S/C24H28N2O8S/c1-3-22(27)18-5-7-19(8-6-18)33-16-24(29)34-15-23(28)25-21-14-20(9-4-17(21)2)35(30,31)26-10-12-32-13-11-26/h4-9,14H,3,10-13,15-16H2,1-2H3,(H,25,28) |
| InChIKey | KEBPXARRKTWISM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |