C22H19ClN2O8S — CID 3436179
[2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 3436179) has the molecular formula C22H19ClN2O8S and a molecular weight of 506.92 g/mol. Its IUPAC name is [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 3436179 |
| Molecular Formula | C22H19ClN2O8S |
| Molecular Weight | 506.92 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | [2-(2-chloro-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)c2ccccc2o1)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C22H19ClN2O8S/c23-16-6-5-14(34(29,30)25-7-9-31-10-8-25)11-17(16)24-21(27)13-32-22(28)20-12-18(26)15-3-1-2-4-19(15)33-20/h1-6,11-12H,7-10,13H2,(H,24,27) |
| InChIKey | ISEPWCQKMMVXDK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 132.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.92 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |