C25H26N2O7S — CID 4839115
[2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 4839115) has the molecular formula C25H26N2O7S and a molecular weight of 498.56 g/mol. Its IUPAC name is [2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 4839115 |
| Molecular Formula | C25H26N2O7S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | [2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2cc(=O)c3ccccc3o2)cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C25H26N2O7S/c1-17-10-11-18(14-23(17)35(31,32)27-12-6-2-3-7-13-27)26-24(29)16-33-25(30)22-15-20(28)19-8-4-5-9-21(19)34-22/h4-5,8-11,14-15H,2-3,6-7,12-13,16H2,1H3,(H,26,29) |
| InChIKey | UDTIRKCOTATKOU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |