C22H26FN3O5S — CID 27997816
[2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate (PubChem CID 27997816) has the molecular formula C22H26FN3O5S and a molecular weight of 463.53 g/mol. Its IUPAC name is [2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate.
| Compound Name | [2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 27997816 |
| Molecular Formula | C22H26FN3O5S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | [2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 2-amino-4-fluorobenzoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccc(F)cc2N)cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C22H26FN3O5S/c1-15-6-8-17(13-20(15)32(29,30)26-10-4-2-3-5-11-26)25-21(27)14-31-22(28)18-9-7-16(23)12-19(18)24/h6-9,12-13H,2-5,10-11,14,24H2,1H3,(H,25,27) |
| InChIKey | ROGIVAJKRNFIJF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|