C22H26N2O6S — CID 42962828
[2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2,5-dimethylbenzoate (PubChem CID 42962828) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2,5-dimethylbenzoate.
| Compound Name | [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 42962828 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2,5-dimethylbenzoate |
| SMILES | Cc1ccc(C)c(C(=O)OCC(=O)Nc2ccc(C)c(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C22H26N2O6S/c1-15-4-5-16(2)19(12-15)22(26)30-14-21(25)23-18-7-6-17(3)20(13-18)31(27,28)24-8-10-29-11-9-24/h4-7,12-13H,8-11,14H2,1-3H3,(H,23,25) |
| InChIKey | NMHHBXWVHWMSNU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |