C17H20N4O6S — CID 55645993
[2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 1H-pyrazole-5-carboxylate (PubChem CID 55645993) has the molecular formula C17H20N4O6S and a molecular weight of 408.44 g/mol. Its IUPAC name is [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 1H-pyrazole-5-carboxylate.
| Compound Name | [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 55645993 |
| Molecular Formula | C17H20N4O6S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 1H-pyrazole-5-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2ccn[nH]2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H20N4O6S/c1-12-2-3-13(10-15(12)28(24,25)21-6-8-26-9-7-21)19-16(22)11-27-17(23)14-4-5-18-20-14/h2-5,10H,6-9,11H2,1H3,(H,18,20)(H,19,22) |
| InChIKey | WQVIRVGGPGGLHF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 130.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |