C21H23ClN2O7S — CID 27985457
[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-methoxy-4-methylbenzoate (PubChem CID 27985457) has the molecular formula C21H23ClN2O7S and a molecular weight of 482.94 g/mol. Its IUPAC name is [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-methoxy-4-methylbenzoate.
| Compound Name | [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-methoxy-4-methylbenzoate |
|---|---|
| PubChem CID | 27985457 |
| Molecular Formula | C21H23ClN2O7S |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-methoxy-4-methylbenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)ccc1C |
| InChI | InChI=1S/C21H23ClN2O7S/c1-14-3-4-15(11-18(14)29-2)21(26)31-13-20(25)23-16-5-6-17(22)19(12-16)32(27,28)24-7-9-30-10-8-24/h3-6,11-12H,7-10,13H2,1-2H3,(H,23,25) |
| InChIKey | RLCBRTLDJMFTMO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |