C24H27ClN2O9S — CID 6186952
[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 6186952) has the molecular formula C24H27ClN2O9S and a molecular weight of 555.01 g/mol. Its IUPAC name is [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6186952 |
| Molecular Formula | C24H27ClN2O9S |
| Molecular Weight | 555.01 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H27ClN2O9S/c1-32-19-12-16(13-20(33-2)24(19)34-3)4-7-23(29)36-15-22(28)26-17-5-6-18(25)21(14-17)37(30,31)27-8-10-35-11-9-27/h4-7,12-14H,8-11,15H2,1-3H3,(H,26,28)/b7-4+ |
| InChIKey | QAICKRCWVRUASO-QPJJXVBHSA-N |
| XLogP | 2.58 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.01 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|