C19H20Cl2N2O5S — CID 25438234
2-(3,4-dichlorophenyl)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 25438234) has the molecular formula C19H20Cl2N2O5S and a molecular weight of 459.35 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 25438234 |
| Molecular Formula | C19H20Cl2N2O5S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cc2ccc(Cl)c(Cl)c2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H20Cl2N2O5S/c1-27-17-5-3-14(12-18(17)29(25,26)23-6-8-28-9-7-23)22-19(24)11-13-2-4-15(20)16(21)10-13/h2-5,10,12H,6-9,11H2,1H3,(H,22,24) |
| InChIKey | OINPEUTXZDRSRH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |