C20H24ClN3O6S — CID 26438859
2-(3-chloro-4-methoxyanilino)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 26438859) has the molecular formula C20H24ClN3O6S and a molecular weight of 469.95 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyanilino)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(3-chloro-4-methoxyanilino)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 26438859 |
| Molecular Formula | C20H24ClN3O6S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 2-(3-chloro-4-methoxyanilino)-N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | COc1ccc(NCC(=O)Nc2ccc(OC)c(S(=O)(=O)N3CCOCC3)c2)cc1Cl |
| InChI | InChI=1S/C20H24ClN3O6S/c1-28-17-5-3-14(11-16(17)21)22-13-20(25)23-15-4-6-18(29-2)19(12-15)31(26,27)24-7-9-30-10-8-24/h3-6,11-12,22H,7-10,13H2,1-2H3,(H,23,25) |
| InChIKey | SWIDGLLEIKEZER-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|