C18H17Cl3N2O4S — CID 4597385
N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-2-(3,4-dichlorophenyl)acetamide (PubChem CID 4597385) has the molecular formula C18H17Cl3N2O4S and a molecular weight of 463.77 g/mol. Its IUPAC name is N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4597385 |
| Molecular Formula | C18H17Cl3N2O4S |
| Molecular Weight | 463.77 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-2-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H17Cl3N2O4S/c19-14-3-1-12(9-16(14)21)10-18(24)22-13-2-4-15(20)17(11-13)28(25,26)23-5-7-27-8-6-23/h1-4,9,11H,5-8,10H2,(H,22,24) |
| InChIKey | JDHOBGSFJFQKLP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.77 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |