C18H21ClFN3O4S — CID 119678981
2-(4-aminophenyl)-N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)acetamide;hydrochloride (PubChem CID 119678981) has the molecular formula C18H21ClFN3O4S and a molecular weight of 429.90 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)acetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119678981 |
| Molecular Formula | C18H21ClFN3O4S |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-(4-aminophenyl)-N-(4-fluoro-3-morpholin-4-ylsulfonylphenyl)acetamide;hydrochloride |
| SMILES | Cl.Nc1ccc(CC(=O)Nc2ccc(F)c(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C18H20FN3O4S.ClH/c19-16-6-5-15(21-18(23)11-13-1-3-14(20)4-2-13)12-17(16)27(24,25)22-7-9-26-10-8-22;/h1-6,12H,7-11,20H2,(H,21,23);1H |
| InChIKey | FLUPTUKIQIBTNW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|