C18H22ClN3O4S — CID 119671802
2-(4-aminophenyl)-N-(3-morpholin-4-ylsulfonylphenyl)acetamide;hydrochloride (PubChem CID 119671802) has the molecular formula C18H22ClN3O4S and a molecular weight of 411.91 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(3-morpholin-4-ylsulfonylphenyl)acetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-(3-morpholin-4-ylsulfonylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119671802 |
| Molecular Formula | C18H22ClN3O4S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 2-(4-aminophenyl)-N-(3-morpholin-4-ylsulfonylphenyl)acetamide;hydrochloride |
| SMILES | Cl.Nc1ccc(CC(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C18H21N3O4S.ClH/c19-15-6-4-14(5-7-15)12-18(22)20-16-2-1-3-17(13-16)26(23,24)21-8-10-25-11-9-21;/h1-7,13H,8-12,19H2,(H,20,22);1H |
| InChIKey | CUWUQUFYCWCTQU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|