C20H22Cl2N2O5S — CID 16545129
2-(4-chloro-3-ethylphenoxy)-N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 16545129) has the molecular formula C20H22Cl2N2O5S and a molecular weight of 473.38 g/mol. Its IUPAC name is 2-(4-chloro-3-ethylphenoxy)-N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-chloro-3-ethylphenoxy)-N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 16545129 |
| Molecular Formula | C20H22Cl2N2O5S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 2-(4-chloro-3-ethylphenoxy)-N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | CCc1cc(OCC(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)ccc1Cl |
| InChI | InChI=1S/C20H22Cl2N2O5S/c1-2-14-11-16(4-6-17(14)21)29-13-20(25)23-15-3-5-18(22)19(12-15)30(26,27)24-7-9-28-10-8-24/h3-6,11-12H,2,7-10,13H2,1H3,(H,23,25) |
| InChIKey | UJFFUQGVOAZIGQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |