C19H20ClN3O6S — CID 55680625
3-[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethoxy]benzamide (PubChem CID 55680625) has the molecular formula C19H20ClN3O6S and a molecular weight of 453.90 g/mol. Its IUPAC name is 3-[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethoxy]benzamide.
| Compound Name | 3-[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 55680625 |
| Molecular Formula | C19H20ClN3O6S |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 3-[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethoxy]benzamide |
| SMILES | NC(=O)c1cccc(OCC(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C19H20ClN3O6S/c20-16-5-4-14(11-17(16)30(26,27)23-6-8-28-9-7-23)22-18(24)12-29-15-3-1-2-13(10-15)19(21)25/h1-5,10-11H,6-9,12H2,(H2,21,25)(H,22,24) |
| InChIKey | WGQCKGWIQRTVJT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |