C21H23ClN2O6S2 — CID 42963403
[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-phenylsulfanylpropanoate (PubChem CID 42963403) has the molecular formula C21H23ClN2O6S2 and a molecular weight of 499.01 g/mol. Its IUPAC name is [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-phenylsulfanylpropanoate.
| Compound Name | [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 42963403 |
| Molecular Formula | C21H23ClN2O6S2 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-phenylsulfanylpropanoate |
| SMILES | O=C(COC(=O)CCSc1ccccc1)Nc1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H23ClN2O6S2/c22-18-7-6-16(14-19(18)32(27,28)24-9-11-29-12-10-24)23-20(25)15-30-21(26)8-13-31-17-4-2-1-3-5-17/h1-7,14H,8-13,15H2,(H,23,25) |
| InChIKey | KCHDBUBRZVTOTD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |