C20H23NO5S2 — CID 8853648
(3-morpholin-4-ylsulfonylphenyl)methyl 3-phenylsulfanylpropanoate (PubChem CID 8853648) has the molecular formula C20H23NO5S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)methyl 3-phenylsulfanylpropanoate.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)methyl 3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 8853648 |
| Molecular Formula | C20H23NO5S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)methyl 3-phenylsulfanylpropanoate |
| SMILES | O=C(CCSc1ccccc1)OCc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H23NO5S2/c22-20(9-14-27-18-6-2-1-3-7-18)26-16-17-5-4-8-19(15-17)28(23,24)21-10-12-25-13-11-21/h1-8,15H,9-14,16H2 |
| InChIKey | CNVQWZJASBMQMS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |